cas: 1436504-90-3 — see every product listed under this CAS number, including other names
Ethyl 3-chloro-6-iodopicolinate, ≥95%, ≥95% (CAS 1436504-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DEJT-100mg |
| cas | 1436504-90-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1528.40 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 3338.00 Pln | |
| Chemat | 5g | 6611.60 Pln | |
| Chemat | 10g | 10058.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-chloro-6-iodopyridine-2-carboxylate (CAS 1436504-90-3) is a chemical compound with the molecular formula C8H7ClINO2 and a molecular weight of 311.50 g/mol. IUPAC name: ethyl 3-chloro-6-iodopyridine-2-carboxylate. InChIKey: DGVQCQIFCCGIQR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClINO2 |
|---|---|
| Molecular weight | 311.50 g/mol |
| IUPAC name | ethyl 3-chloro-6-iodopyridine-2-carboxylate |
| InChIKey | DGVQCQIFCCGIQR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=N1)I)Cl |
Computed by PubChem (NCBI)