Products 1934764-78-9

CAS 1934764-78-9 is the registry number for 5-Amino-2-chloro-4-iodo-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 5-amino-2-chloro-4-iodobenzoate (CAS 1934764-78-9) is a chemical compound with the molecular formula C8H7ClINO2 and a molecular weight of 311.50 g/mol. IUPAC name: methyl 5-amino-2-chloro-4-iodobenzoate. InChIKey: GJPSGQLPWJXQOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClINO2
Molecular weight311.50 g/mol
IUPAC namemethyl 5-amino-2-chloro-4-iodobenzoate
InChIKeyGJPSGQLPWJXQOZ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1Cl)I)N

Computed by PubChem (NCBI)