CAS 1070977-94-4 is the registry number for 2-Amino-3-chloro-5-iodo-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-amino-3-chloro-5-iodobenzoate (CAS 1070977-94-4) is a chemical compound with the molecular formula C8H7ClINO2 and a molecular weight of 311.50 g/mol. IUPAC name: methyl 2-amino-3-chloro-5-iodobenzoate. InChIKey: ILDAJGVKPFOKBT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClINO2 |
|---|---|
| Molecular weight | 311.50 g/mol |
| IUPAC name | methyl 2-amino-3-chloro-5-iodobenzoate |
| InChIKey | ILDAJGVKPFOKBT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)I)Cl)N |
Computed by PubChem (NCBI)