Products 2586127-42-4
CAS 2586127-42-4 is the registry number for 2-Chloro-3-(1,3-dioxolan-2-yl)-4-iodopyridine, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
2-chloro-3-(1,3-dioxolan-2-yl)-4-iodopyridine (CAS 2586127-42-4) is a chemical compound with the molecular formula C8H7ClINO2 and a molecular weight of 311.50 g/mol. IUPAC name: 2-chloro-3-(1,3-dioxolan-2-yl)-4-iodopyridine. InChIKey: CJRNZONMWXJSHW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClINO2 |
|---|---|
| Molecular weight | 311.50 g/mol |
| IUPAC name | 2-chloro-3-(1,3-dioxolan-2-yl)-4-iodopyridine |
| InChIKey | CJRNZONMWXJSHW-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CN=C2Cl)I |
Computed by PubChem (NCBI)