cas: 13599-24-1 — see every product listed under this CAS number, including other names
Ethyl 3-phenylisoxazole-5-carboxylate 97% (CAS 13599-24-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A171415-250mg |
| cas | 13599-24-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1065.69 Pln | |
| Ambeed | 10g | 1888.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A171415 |
Ethyl 3-phenyl-1,2-oxazole-5-carboxylate (CAS 13599-24-1) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: ethyl 3-phenyl-1,2-oxazole-5-carboxylate. InChIKey: XYKADOXYAZEDNB-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | ethyl 3-phenyl-1,2-oxazole-5-carboxylate |
| InChIKey | XYKADOXYAZEDNB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NO1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)