CAS 1717-41-5 is the registry number for Ethyl 4,4,4-trifluoro-3-oxo-2-phenylbutanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 4,4,4-trifluoro-3-oxo-2-phenylbutanoate (CAS 1717-41-5) is a chemical compound with the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. IUPAC name: ethyl 4,4,4-trifluoro-3-oxo-2-phenylbutanoate. InChIKey: HUGYYFQQENWPFS-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O3 |
|---|---|
| Molecular weight | 260.21 g/mol |
| IUPAC name | ethyl 4,4,4-trifluoro-3-oxo-2-phenylbutanoate |
| InChIKey | HUGYYFQQENWPFS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)