cas: 19282-45-2 — see every product listed under this CAS number, including other names
Ethyl 4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylate 98+% (CAS 19282-45-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A115799-250mg |
| cas | 19282-45-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 693.00 Pln | |
| Ambeed | 10g | 1193.62 Pln | |
| Ambeed | 25g | 2534.19 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A115799 |
Ethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (CAS 19282-45-2) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: ethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate. InChIKey: BNSTWYGMSUJOFU-UHFFFAOYSA-N.
| Molecular formula | C11H14O2S |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | ethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| InChIKey | BNSTWYGMSUJOFU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)CCCC2 |
Computed by PubChem (NCBI)