cas: 1449598-76-8 — see every product listed under this CAS number, including other names
Ethyl 4,6-Dimethylpyrazolo[1,5-a]pyrazine-2-carboxylate, >96%, >96% (CAS 1449598-76-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXCJ-100mg |
| cas | 1449598-76-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 832.40 Pln | |
| Chemat | 250mg | 1221.20 Pln | |
| Chemat | 1g | 2958.80 Pln |
| purity | >96% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4,6-dimethylpyrazolo[1,5-a]pyrazine-2-carboxylate (CAS 1449598-76-8) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: ethyl 4,6-dimethylpyrazolo[1,5-a]pyrazine-2-carboxylate. InChIKey: PWHWSSBNPRHDJB-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | ethyl 4,6-dimethylpyrazolo[1,5-a]pyrazine-2-carboxylate |
| InChIKey | PWHWSSBNPRHDJB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN2C=C(N=C(C2=C1)C)C |
Computed by PubChem (NCBI)