cas: 150449-99-3 — see every product listed under this CAS number, including other names
Ethyl 4,6-dichloroquinazoline-2-carboxylate 97% (CAS 150449-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A779859-100mg |
| cas | 150449-99-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 2155.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A779859 |
Ethyl 4,6-dichloroquinazoline-2-carboxylate (CAS 150449-99-3) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: ethyl 4,6-dichloroquinazoline-2-carboxylate. InChIKey: NOPBSKCNIZYGHU-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | ethyl 4,6-dichloroquinazoline-2-carboxylate |
| InChIKey | NOPBSKCNIZYGHU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C(C=C2)Cl)C(=N1)Cl |
Computed by PubChem (NCBI)