cas: 150449-99-3 — see every product listed under this CAS number, including other names
Ethyl 4,6-dichloroquinazoline-2-carboxylate, 95%, 95% (CAS 150449-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112MMV-100mg |
| cas | 150449-99-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2334.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4,6-dichloroquinazoline-2-carboxylate (CAS 150449-99-3) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: ethyl 4,6-dichloroquinazoline-2-carboxylate. InChIKey: NOPBSKCNIZYGHU-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | ethyl 4,6-dichloroquinazoline-2-carboxylate |
| InChIKey | NOPBSKCNIZYGHU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C(C=C2)Cl)C(=N1)Cl |
Computed by PubChem (NCBI)