CAS 192702-24-2 appears in our catalog under these names: Methyl 5-(3,4-dichlorophenyl)-1h-pyrazole-3-carboxylate, 95%, Methyl 5-(3,4-dichlorophenyl)-1H-pyrazole-3-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
Methyl 3-(3,4-dichlorophenyl)-1H-pyrazole-5-carboxylate (CAS 192702-24-2) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: methyl 3-(3,4-dichlorophenyl)-1H-pyrazole-5-carboxylate. InChIKey: KINFFVOVDYZUSF-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | methyl 3-(3,4-dichlorophenyl)-1H-pyrazole-5-carboxylate |
| InChIKey | KINFFVOVDYZUSF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NN1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)