CAS 1189106-09-9 is the registry number for Ethyl 4,7-dichloroquinazoline-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 4,7-dichloroquinazoline-2-carboxylate (CAS 1189106-09-9) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: ethyl 4,7-dichloroquinazoline-2-carboxylate. InChIKey: SLYQQUNSFUMFFQ-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | ethyl 4,7-dichloroquinazoline-2-carboxylate |
| InChIKey | SLYQQUNSFUMFFQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=CC(=C2)Cl)C(=N1)Cl |
Computed by PubChem (NCBI)