cas: 871673-11-9 — see every product listed under this CAS number, including other names
Ethyl 4-(3-bromophenyl)thiazole-2-carboxylate, 97% (CAS 871673-11-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447189-100MG |
| cas | 871673-11-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 544.62 Pln | |
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 1g | 1549.47 Pln | |
| Fluorochem | 5g | 5214.85 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-(3-bromophenyl)-1,3-thiazole-2-carboxylate (CAS 871673-11-9) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: ethyl 4-(3-bromophenyl)-1,3-thiazole-2-carboxylate. InChIKey: NQWDLNQDIXUKNF-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | ethyl 4-(3-bromophenyl)-1,3-thiazole-2-carboxylate |
| InChIKey | NQWDLNQDIXUKNF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)