cas: 53101-02-3 — see every product listed under this CAS number, including other names
Ethyl 4-(4-Bromophenyl)thiazole-2-carboxylate, 97%, 97% (CAS 53101-02-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114Q9Z-100mg |
| cas | 53101-02-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 2507.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-(4-bromophenyl)-1,3-thiazole-2-carboxylate (CAS 53101-02-3) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: ethyl 4-(4-bromophenyl)-1,3-thiazole-2-carboxylate. InChIKey: XGCLHKIDYQWOAC-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | ethyl 4-(4-bromophenyl)-1,3-thiazole-2-carboxylate |
| InChIKey | XGCLHKIDYQWOAC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)