cas: 53101-04-5 — see every product listed under this CAS number, including other names
Ethyl 4-(4-Nitrophenyl)thiazole-2-carboxylate, 97%, 97% (CAS 53101-04-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114Q03-1g |
| cas | 53101-04-5 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 698.00 Pln | |
| Chemat | 5g | 2507.60 Pln | |
| Chemat | 250mg | 338.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-(4-nitrophenyl)-1,3-thiazole-2-carboxylate (CAS 53101-04-5) is a chemical compound with the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. IUPAC name: ethyl 4-(4-nitrophenyl)-1,3-thiazole-2-carboxylate. InChIKey: BAWZXPJKMSLAOI-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4S |
|---|---|
| Molecular weight | 278.29 g/mol |
| IUPAC name | ethyl 4-(4-nitrophenyl)-1,3-thiazole-2-carboxylate |
| InChIKey | BAWZXPJKMSLAOI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)