cas: 40155-54-2 — see every product listed under this CAS number, including other names
Ethyl 4-(4-bromophenyl)-2,4-dioxobutanoate, 97% (CAS 40155-54-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F458642-1G |
| cas | 40155-54-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1028.82 Pln | |
| Fluorochem | 5g | 2934.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-(4-bromophenyl)-2,4-dioxobutanoate (CAS 40155-54-2) is a chemical compound with the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. IUPAC name: ethyl 4-(4-bromophenyl)-2,4-dioxobutanoate. InChIKey: YAXZGVSOAFLCQS-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO4 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | ethyl 4-(4-bromophenyl)-2,4-dioxobutanoate |
| InChIKey | YAXZGVSOAFLCQS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)