Products 40155-54-2
CAS 40155-54-2 appears in our catalog under these names: Ethyl 4-(4-bromophenyl)-2,4-dioxobutanoate, 98%, Ethyl 4-(4-bromophenyl)-2,4-dioxobutanoate, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g.
Ethyl 4-(4-bromophenyl)-2,4-dioxobutanoate (CAS 40155-54-2) is a chemical compound with the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. IUPAC name: ethyl 4-(4-bromophenyl)-2,4-dioxobutanoate. InChIKey: YAXZGVSOAFLCQS-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO4 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | ethyl 4-(4-bromophenyl)-2,4-dioxobutanoate |
| InChIKey | YAXZGVSOAFLCQS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)