CAS 88404-25-5 appears in our catalog under these names: 4-Bromomethyl-6,7-dimethoxycoumarin, 95%, 4-(Bromomethyl)-6,7-dimethoxycoumarin, 4–Bromomethyl–6,7–dimethoxycoumarin, 4-Bromomethyl-6,7-dimethoxycoumarin, 95% , 4-Bromomethyl-6,7-dimethoxycoumarin [for HPLC Labeling], >98.0%(HPLC). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100mg, 1g, 250mg, 500mg, 2g, 0.1g, 50mg, 100 mg.
4-(bromomethyl)-6,7-dimethoxychromen-2-one (CAS 88404-25-5) is a chemical compound with the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. IUPAC name: 4-(bromomethyl)-6,7-dimethoxychromen-2-one. InChIKey: JGODLBJJCNQFII-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO4 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | 4-(bromomethyl)-6,7-dimethoxychromen-2-one |
| InChIKey | JGODLBJJCNQFII-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CC(=O)O2)CBr)OC |
Computed by PubChem (NCBI)