CAS 1820711-99-6 is the registry number for methyl 2-(5-bromo-2-oxo-3,4-dihydro-1-benzopyran-4-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(5-bromo-2-oxo-3,4-dihydrochromen-4-yl)acetate (CAS 1820711-99-6) is a chemical compound with the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. IUPAC name: methyl 2-(5-bromo-2-oxo-3,4-dihydrochromen-4-yl)acetate. InChIKey: MYMPXRWRZKXLDZ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO4 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | methyl 2-(5-bromo-2-oxo-3,4-dihydrochromen-4-yl)acetate |
| InChIKey | MYMPXRWRZKXLDZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1CC(=O)OC2=C1C(=CC=C2)Br |
Computed by PubChem (NCBI)