cas: 886366-42-3 — see every product listed under this CAS number, including other names
Ethyl 4-(4-methoxyphenyl)thiazole-2-carboxylate, 95%, 95% (CAS 886366-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GS52-100mg |
| cas | 886366-42-3 |
| size | 100mg |
| availability | 1.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1787.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-(4-methoxyphenyl)-1,3-thiazole-2-carboxylate (CAS 886366-42-3) is a chemical compound with the molecular formula C13H13NO3S and a molecular weight of 263.31 g/mol. IUPAC name: ethyl 4-(4-methoxyphenyl)-1,3-thiazole-2-carboxylate. InChIKey: XOHMQJLCGMBICX-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | ethyl 4-(4-methoxyphenyl)-1,3-thiazole-2-carboxylate |
| InChIKey | XOHMQJLCGMBICX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)