cas: 76360-82-2 — see every product listed under this CAS number, including other names
Ethyl 4-(methylamino)-2-(methylsulfanyl)-5-pyrimidinecarboxylate, 97% (CAS 76360-82-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227819-1G |
| cas | 76360-82-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 10g | 700.81 Pln | |
| Fluorochem | 25g | 1658.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-(methylamino)-2-methylsulfanylpyrimidine-5-carboxylate (CAS 76360-82-2) is a chemical compound with the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. IUPAC name: ethyl 4-(methylamino)-2-methylsulfanylpyrimidine-5-carboxylate. InChIKey: VDDZMXQAZJMGPK-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | ethyl 4-(methylamino)-2-methylsulfanylpyrimidine-5-carboxylate |
| InChIKey | VDDZMXQAZJMGPK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1NC)SC |
Computed by PubChem (NCBI)