Products 1566081-08-0

CAS 1566081-08-0 is the registry number for 4-(1-Methyl-1H-imidazol-2-yl)thiomorpholine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(1-methylimidazol-2-yl)thiomorpholine-3-carboxylic acid (CAS 1566081-08-0) is a chemical compound with the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. IUPAC name: 4-(1-methylimidazol-2-yl)thiomorpholine-3-carboxylic acid. InChIKey: FHKCRADFJSHJMA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13N3O2S
Molecular weight227.29 g/mol
IUPAC name4-(1-methylimidazol-2-yl)thiomorpholine-3-carboxylic acid
InChIKeyFHKCRADFJSHJMA-UHFFFAOYSA-N
SMILESCN1C=CN=C1N2CCSCC2C(=O)O

Computed by PubChem (NCBI)