CAS 2766052-65-5 is the registry number for (R)-6-Methyl-2-(methylsulfonyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6R)-6-methyl-2-methylsulfonyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine (CAS 2766052-65-5) is a chemical compound with the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. IUPAC name: (6R)-6-methyl-2-methylsulfonyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine. InChIKey: SJVHOOBSTHMFCS-ZCFIWIBFSA-N.
| Molecular formula | C9H13N3O2S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | (6R)-6-methyl-2-methylsulfonyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
| InChIKey | SJVHOOBSTHMFCS-ZCFIWIBFSA-N |
| SMILES | C[C@@H]1CC2=CN=C(N=C2CN1)S(=O)(=O)C |
Computed by PubChem (NCBI)