Products 1491159-20-6

CAS 1491159-20-6 is the registry number for 4-(Methylthio)-2-(pyrimidin-2-ylamino)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

4-methylsulfanyl-2-(pyrimidin-2-ylamino)butanoic acid (CAS 1491159-20-6) is a chemical compound with the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. IUPAC name: 4-methylsulfanyl-2-(pyrimidin-2-ylamino)butanoic acid. InChIKey: NVBBOWJRDCEIAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13N3O2S
Molecular weight227.29 g/mol
IUPAC name4-methylsulfanyl-2-(pyrimidin-2-ylamino)butanoic acid
InChIKeyNVBBOWJRDCEIAQ-UHFFFAOYSA-N
SMILESCSCCC(C(=O)O)NC1=NC=CC=N1

Computed by PubChem (NCBI)