cas: 1804145-60-5 — see every product listed under this CAS number, including other names
Ethyl 4-Amino-5-fluoropyridine-2-carboxylate, >97%, >97% (CAS 1804145-60-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DES6-100mg |
| cas | 1804145-60-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1062.80 Pln | |
| Chemat | 250mg | 1662.80 Pln | |
| Chemat | 1g | 4062.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-amino-5-fluoropyridine-2-carboxylate (CAS 1804145-60-5) is a chemical compound with the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. IUPAC name: ethyl 4-amino-5-fluoropyridine-2-carboxylate. InChIKey: WETHRCVLRAXBAE-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O2 |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | ethyl 4-amino-5-fluoropyridine-2-carboxylate |
| InChIKey | WETHRCVLRAXBAE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(C(=C1)N)F |
Computed by PubChem (NCBI)