cas: 1186663-51-3 — see every product listed under this CAS number, including other names
Ethyl 4-allylpiperidine-4-carboxylate hydrochloride 98% (CAS 1186663-51-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A281076-250mg |
| cas | 1186663-51-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 654.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A281076 |
Ethyl 4-prop-2-enylpiperidine-4-carboxylate;hydrochloride (CAS 1186663-51-3) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: ethyl 4-prop-2-enylpiperidine-4-carboxylate;hydrochloride. InChIKey: REMKTWLYWWGNEV-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | ethyl 4-prop-2-enylpiperidine-4-carboxylate;hydrochloride |
| InChIKey | REMKTWLYWWGNEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCNCC1)CC=C.Cl |
Computed by PubChem (NCBI)