Products 1255717-93-1

CAS 1255717-93-1 is the registry number for 1-(1-Pyrrolidinyl)cyclohexanecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-pyrrolidin-1-ylcyclohexane-1-carboxylic acid;hydrochloride (CAS 1255717-93-1) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: 1-pyrrolidin-1-ylcyclohexane-1-carboxylic acid;hydrochloride. InChIKey: JNRFPRKDXKHARU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20ClNO2
Molecular weight233.73 g/mol
IUPAC name1-pyrrolidin-1-ylcyclohexane-1-carboxylic acid;hydrochloride
InChIKeyJNRFPRKDXKHARU-UHFFFAOYSA-N
SMILESC1CCC(CC1)(C(=O)O)N2CCCC2.Cl

Computed by PubChem (NCBI)