CAS 479057-79-9 appears in our catalog under these names: 4-Chloromethyl-piperidine-1-carboxylic acid tert-butyl ester, 97%, 1–Boc–4–(chloromethyl)piperidine, tert-Butyl 4-(chloromethyl)tetrahydro-1(2H)-pyridinecarboxylate 97%, 1-Boc-4-(chloromethyl)piperidine, 97%, 97%, 4-Chloromethyl-piperidine-1-carboxylic acid tert-butyl ester, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg.
Tert-butyl 4-(chloromethyl)piperidine-1-carboxylate (CAS 479057-79-9) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: tert-butyl 4-(chloromethyl)piperidine-1-carboxylate. InChIKey: CTSABEXZMPJSGO-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | tert-butyl 4-(chloromethyl)piperidine-1-carboxylate |
| InChIKey | CTSABEXZMPJSGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCl |
Computed by PubChem (NCBI)