cas: 1186663-51-3 — see every product listed under this CAS number, including other names
Ethyl 4-allyl-4-piperidinecarboxylate, HCl, 95%, 95% (CAS 1186663-51-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1100MS-250mg |
| cas | 1186663-51-3 |
| size | 250mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 100mg | 88.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-prop-2-enylpiperidine-4-carboxylate;hydrochloride (CAS 1186663-51-3) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: ethyl 4-prop-2-enylpiperidine-4-carboxylate;hydrochloride. InChIKey: REMKTWLYWWGNEV-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | ethyl 4-prop-2-enylpiperidine-4-carboxylate;hydrochloride |
| InChIKey | REMKTWLYWWGNEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCNCC1)CC=C.Cl |
Computed by PubChem (NCBI)