CAS 74450-59-2 appears in our catalog under these names: Ethyl 4-amino-2-methylbenzoate, 98%, 4-Amino-2-methylbenzoic acid ethyl ester, Ethyl 4-amino-2-methylbenzoate, 98%, 98%, 4-Amino-2-methylbenzoic acid ethyl ester, 98%. Offered by: Ambeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 0,05kg.
Ethyl 4-amino-2-methylbenzoate (CAS 74450-59-2) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: ethyl 4-amino-2-methylbenzoate. InChIKey: RXVUWRNRNRPYMT-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | ethyl 4-amino-2-methylbenzoate |
| InChIKey | RXVUWRNRNRPYMT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)N)C |
Computed by PubChem (NCBI)