CAS 7149-03-3 is the registry number for Ethyl 4-amino-3-bromobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
Ethyl 4-amino-3-bromobenzoate (CAS 7149-03-3) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: ethyl 4-amino-3-bromobenzoate. InChIKey: NOGUJGZZMMKQOZ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | ethyl 4-amino-3-bromobenzoate |
| InChIKey | NOGUJGZZMMKQOZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)Br |
Computed by PubChem (NCBI)