cas: 50476-72-7 — see every product listed under this CAS number, including other names
Ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate, 95%, 95% (CAS 50476-72-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DHWF-50mg |
| cas | 50476-72-7 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 458.00 Pln | |
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 856.40 Pln | |
| Chemat | 1g | 1758.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate (CAS 50476-72-7) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate. InChIKey: PJMVISKPSDWZFO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate |
| InChIKey | PJMVISKPSDWZFO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C1Cl)C=NN2 |
Computed by PubChem (NCBI)