CAS 1311317-30-2 is the registry number for 3-(1H-1,2,4-Triazol-1-yl)benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
3-(1,2,4-triazol-1-yl)benzoic acid;hydrochloride (CAS 1311317-30-2) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: 3-(1,2,4-triazol-1-yl)benzoic acid;hydrochloride. InChIKey: UUPRLQSAVKSCAK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | 3-(1,2,4-triazol-1-yl)benzoic acid;hydrochloride |
| InChIKey | UUPRLQSAVKSCAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=NC=N2)C(=O)O.Cl |
Computed by PubChem (NCBI)