CAS 1250996-90-7 is the registry number for Ethyl 5-chloroimidazo[1,5-a]pyrazine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Ethyl 5-chloroimidazo[1,5-a]pyrazine-1-carboxylate (CAS 1250996-90-7) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 5-chloroimidazo[1,5-a]pyrazine-1-carboxylate. InChIKey: FJDWATOOVGSVIB-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 5-chloroimidazo[1,5-a]pyrazine-1-carboxylate |
| InChIKey | FJDWATOOVGSVIB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C=NC=C(N2C=N1)Cl |
Computed by PubChem (NCBI)