Products 1628946-63-3
CAS 1628946-63-3 is the registry number for Ethyl 6-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Ethyl 6-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate (CAS 1628946-63-3) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 6-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate. InChIKey: BHBMPVQCORALLK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 6-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate |
| InChIKey | BHBMPVQCORALLK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C2N1C=C(C=C2)Cl |
Computed by PubChem (NCBI)