cas: 853058-42-1 — see every product listed under this CAS number, including other names
Ethyl 4-chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylate, 96% (CAS 853058-42-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217454-100MG |
| cas | 853058-42-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 893.45 Pln | |
| Fluorochem | 250mg | 1169.40 Pln | |
| Fluorochem | 500mg | 1908.72 Pln | |
| Fluorochem | 1g | 2819.86 Pln | |
| Fluorochem | 5g | 8838.57 Pln | |
| Fluorochem | 10g | 13826.40 Pln | |
| Fluorochem | 25g | 24760.05 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylate (CAS 853058-42-1) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 4-chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylate. InChIKey: RJYXGAURZSGDON-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 4-chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylate |
| InChIKey | RJYXGAURZSGDON-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C1N=CN=C2Cl |
Computed by PubChem (NCBI)