cas: 39974-01-1 — see every product listed under this CAS number, including other names
Ethyl 4-hydroxy-α,γ-dioxobenzenebutanoate, 97% (CAS 39974-01-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554034-100MG |
| cas | 39974-01-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 539.41 Pln | |
| Fluorochem | 1g | 1403.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-(4-hydroxyphenyl)-2,4-dioxobutanoate (CAS 39974-01-1) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: ethyl 4-(4-hydroxyphenyl)-2,4-dioxobutanoate. InChIKey: GRZUZCSOAWGWIB-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | ethyl 4-(4-hydroxyphenyl)-2,4-dioxobutanoate |
| InChIKey | GRZUZCSOAWGWIB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)