cas: 39974-01-1 — see every product listed under this CAS number, including other names
Ethyl 4-hydroxy-α,γ-dioxobenzenebutanoate, 97%, 97% (CAS 39974-01-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EMPO-100mg |
| cas | 39974-01-1 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 962.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-(4-hydroxyphenyl)-2,4-dioxobutanoate (CAS 39974-01-1) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: ethyl 4-(4-hydroxyphenyl)-2,4-dioxobutanoate. InChIKey: GRZUZCSOAWGWIB-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | ethyl 4-(4-hydroxyphenyl)-2,4-dioxobutanoate |
| InChIKey | GRZUZCSOAWGWIB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)