cas: 319442-19-8 — see every product listed under this CAS number, including other names
Ethyl 4-oxo-3,4-dihydrothieno[3,2-d]pyrimidine-2-carboxylate, 98%, 98% (CAS 319442-19-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CM62-10g |
| cas | 319442-19-8 |
| size | 10g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2430.80 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1408.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-oxo-3H-thieno[3,2-d]pyrimidine-2-carboxylate (CAS 319442-19-8) is a chemical compound with the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. IUPAC name: ethyl 4-oxo-3H-thieno[3,2-d]pyrimidine-2-carboxylate. InChIKey: MZMHHCYVZKHGQJ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | ethyl 4-oxo-3H-thieno[3,2-d]pyrimidine-2-carboxylate |
| InChIKey | MZMHHCYVZKHGQJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C(=O)N1)SC=C2 |
Computed by PubChem (NCBI)