cas: 238749-53-6 — see every product listed under this CAS number, including other names
Ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate, 97% (CAS 238749-53-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602509-100MG |
| cas | 238749-53-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 768.50 Pln | |
| Fluorochem | 5g | 3455.05 Pln | |
| Fluorochem | 10g | 6224.91 Pln | |
| Fluorochem | 25g | 14685.47 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate (CAS 238749-53-6) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate. InChIKey: BXACPZGBYFAFIX-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate |
| InChIKey | BXACPZGBYFAFIX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)N=CS2 |
Computed by PubChem (NCBI)