cas: 90924-54-2 — see every product listed under this CAS number, including other names
Ethyl 5-(thiophen-2-yl)isoxazole-3-carboxylate 95% (CAS 90924-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A194167-100mg |
| cas | 90924-54-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 592.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A194167 |
Ethyl 5-thiophen-2-yl-1,2-oxazole-3-carboxylate (CAS 90924-54-2) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: ethyl 5-thiophen-2-yl-1,2-oxazole-3-carboxylate. InChIKey: YPIUQIUZEYMWAX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | ethyl 5-thiophen-2-yl-1,2-oxazole-3-carboxylate |
| InChIKey | YPIUQIUZEYMWAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC=CS2 |
Computed by PubChem (NCBI)