CAS 1050885-30-7 appears in our catalog under these names: [2-(5-Methyl-2-furyl)-1,3-thiazol-4-yl]acetic acid, 95%, 2-(2-(5-Methylfuran-2-yl)-1,3-thiazol-4-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid (CAS 1050885-30-7) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid. InChIKey: YDVDHYNCXQZRMG-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | YDVDHYNCXQZRMG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)