cas: 90924-54-2 — see every product listed under this CAS number, including other names
Ethyl 5-(thiophen-2-yl)isoxazole-3-carboxylate, 95%, 95% (CAS 90924-54-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GVPI-250mg |
| cas | 90924-54-2 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 654.80 Pln | |
| Chemat | 5g | 2147.60 Pln | |
| Chemat | 100mg | 198.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-thiophen-2-yl-1,2-oxazole-3-carboxylate (CAS 90924-54-2) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: ethyl 5-thiophen-2-yl-1,2-oxazole-3-carboxylate. InChIKey: YPIUQIUZEYMWAX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | ethyl 5-thiophen-2-yl-1,2-oxazole-3-carboxylate |
| InChIKey | YPIUQIUZEYMWAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC=CS2 |
Computed by PubChem (NCBI)