Products 99513-52-7

CAS 99513-52-7 appears in our catalog under these names: (1,3-Benzothiazol-2-ylmethoxy)acetic acid, 98%, (1,3-benzothiazol-2-ylmethoxy)acetic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(1,3-benzothiazol-2-ylmethoxy)acetic acid (CAS 99513-52-7) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-ylmethoxy)acetic acid. InChIKey: RQFMQUWXKKGYMC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO3S
Molecular weight223.25 g/mol
IUPAC name2-(1,3-benzothiazol-2-ylmethoxy)acetic acid
InChIKeyRQFMQUWXKKGYMC-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)N=C(S2)COCC(=O)O

Computed by PubChem (NCBI)