CAS 6270-74-2 appears in our catalog under these names: 2-(3-Oxo-3,4-dihydro-2H-benzo(b)(1,4)thiazin-2-yl)acetic acid, 97%, (3-Oxo-3,4-dihydro-2h-1,4-benzothiazin-2-yl)acetic acid, 98%, 3–Oxo–3,4–dihydro–2H–1,4–benzothiazine–2–acetic Acid, 3,4-Dihydro-3-oxo-2H-(1,4)-benzothiazin-2-ylacetic acid, 3-Oxo-3,4-dihydro-2H-1,4-benzothiazine-2-acetic Acid, >98.0%(HPLC)(T). Offered by: AmBeed, Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 5g, 1g, 10g, 50g, 100g, 100mg, 250mg.
2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetic acid (CAS 6270-74-2) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetic acid. InChIKey: QWXLTZQRYJBZQT-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetic acid |
| InChIKey | QWXLTZQRYJBZQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C(S2)CC(=O)O |
Computed by PubChem (NCBI)