cas: 384835-92-1 — see every product listed under this CAS number, including other names
Ethyl 5-amino-1-(4-methoxybenzyl)-1H-pyrazole-4-carboxylate 97% (CAS 384835-92-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A504604-100mg |
| cas | 384835-92-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 2411.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A504604 |
Ethyl 5-amino-1-[(4-methoxyphenyl)methyl]pyrazole-4-carboxylate (CAS 384835-92-1) is a chemical compound with the molecular formula C14H17N3O3 and a molecular weight of 275.30 g/mol. IUPAC name: ethyl 5-amino-1-[(4-methoxyphenyl)methyl]pyrazole-4-carboxylate. InChIKey: DDLNBTLDLFUKNK-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O3 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | ethyl 5-amino-1-[(4-methoxyphenyl)methyl]pyrazole-4-carboxylate |
| InChIKey | DDLNBTLDLFUKNK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)CC2=CC=C(C=C2)OC)N |
Computed by PubChem (NCBI)