cas: 384835-92-1 — see every product listed under this CAS number, including other names
Ethyl 5-amino-1-(4-methoxybenzyl)-1H-pyrazole-4-carboxylate, 97%, 97% (CAS 384835-92-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AQJ0-100mg |
| cas | 384835-92-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 362.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-amino-1-[(4-methoxyphenyl)methyl]pyrazole-4-carboxylate (CAS 384835-92-1) is a chemical compound with the molecular formula C14H17N3O3 and a molecular weight of 275.30 g/mol. IUPAC name: ethyl 5-amino-1-[(4-methoxyphenyl)methyl]pyrazole-4-carboxylate. InChIKey: DDLNBTLDLFUKNK-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O3 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | ethyl 5-amino-1-[(4-methoxyphenyl)methyl]pyrazole-4-carboxylate |
| InChIKey | DDLNBTLDLFUKNK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)CC2=CC=C(C=C2)OC)N |
Computed by PubChem (NCBI)