cas: 19867-62-0 — see every product listed under this CAS number, including other names
Ethyl 5-amino-1-benzyl-1H-pyrazole-4-carboxylate 98% (CAS 19867-62-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A544270-250mg |
| cas | 19867-62-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 770.88 Pln | |
| Ambeed | 5g | 2378.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A544270 |
Ethyl 5-amino-1-benzylpyrazole-4-carboxylate (CAS 19867-62-0) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: ethyl 5-amino-1-benzylpyrazole-4-carboxylate. InChIKey: SDKPSMKNXBQGQU-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | ethyl 5-amino-1-benzylpyrazole-4-carboxylate |
| InChIKey | SDKPSMKNXBQGQU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)