cas: 19867-62-0 — see every product listed under this CAS number, including other names
Ethyl 5-amino-1-benzyl-1H-pyrazole-4-carboxylate, 98%, 98% (CAS 19867-62-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BOM-1g |
| cas | 19867-62-0 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 539.60 Pln | |
| Chemat | 5g | 1734.80 Pln | |
| Chemat | 250mg | 208.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-amino-1-benzylpyrazole-4-carboxylate (CAS 19867-62-0) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: ethyl 5-amino-1-benzylpyrazole-4-carboxylate. InChIKey: SDKPSMKNXBQGQU-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | ethyl 5-amino-1-benzylpyrazole-4-carboxylate |
| InChIKey | SDKPSMKNXBQGQU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)