cas: 450412-27-8 — see every product listed under this CAS number, including other names
Ethyl 5-bromo-2-iodobenzoate 95% (CAS 450412-27-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A693196-1g |
| cas | 450412-27-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1482.88 Pln | |
| Ambeed | 10g | 2556.44 Pln | |
| Ambeed | 25g | 5760.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A693196 |
Ethyl 5-bromo-2-iodobenzoate (CAS 450412-27-8) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: ethyl 5-bromo-2-iodobenzoate. InChIKey: JWUQSSZXGVRFDZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrIO2 |
|---|---|
| Molecular weight | 354.97 g/mol |
| IUPAC name | ethyl 5-bromo-2-iodobenzoate |
| InChIKey | JWUQSSZXGVRFDZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)I |
Computed by PubChem (NCBI)